C30H30N2O8 — CID 153353205
methyl 3-[1,3-dioxo-4-[(2-phenylmethoxyacetyl)amino]isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanoate (PubChem CID 153353205) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is methyl 3-[1,3-dioxo-4-[(2-phenylmethoxyacetyl)amino]isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanoate.
| Compound Name | methyl 3-[1,3-dioxo-4-[(2-phenylmethoxyacetyl)amino]isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 153353205 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | methyl 3-[1,3-dioxo-4-[(2-phenylmethoxyacetyl)amino]isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanoate |
| SMILES | CCOc1cc(C(CC(=O)OC)N2C(=O)c3cccc(NC(=O)COCc4ccccc4)c3C2=O)ccc1OC |
| InChI | InChI=1S/C30H30N2O8/c1-4-40-25-15-20(13-14-24(25)37-2)23(16-27(34)38-3)32-29(35)21-11-8-12-22(28(21)30(32)36)31-26(33)18-39-17-19-9-6-5-7-10-19/h5-15,23H,4,16-18H2,1-3H3,(H,31,33) |
| InChIKey | GYFSBOMBMNUXNE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|