C24H26N2O7 — CID 175335672
5-amino-4-[1,3-dioxo-4-(4-phenylmethoxybutoxy)isoindol-2-yl]-5-oxopentanoic acid (PubChem CID 175335672) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 5-amino-4-[1,3-dioxo-4-(4-phenylmethoxybutoxy)isoindol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-amino-4-[1,3-dioxo-4-(4-phenylmethoxybutoxy)isoindol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175335672 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 5-amino-4-[1,3-dioxo-4-(4-phenylmethoxybutoxy)isoindol-2-yl]-5-oxopentanoic acid |
| SMILES | NC(=O)C(CCC(=O)O)N1C(=O)c2cccc(OCCCCOCc3ccccc3)c2C1=O |
| InChI | InChI=1S/C24H26N2O7/c25-22(29)18(11-12-20(27)28)26-23(30)17-9-6-10-19(21(17)24(26)31)33-14-5-4-13-32-15-16-7-2-1-3-8-16/h1-3,6-10,18H,4-5,11-15H2,(H2,25,29)(H,27,28) |
| InChIKey | SWKHGFSXBDAYQE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|