C21H31N3O5 — CID 145256251
4-[4-(4-aminobutoxy)-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;propane (PubChem CID 145256251) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[4-(4-aminobutoxy)-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;propane.
| Compound Name | 4-[4-(4-aminobutoxy)-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;propane |
|---|---|
| PubChem CID | 145256251 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 4-[4-(4-aminobutoxy)-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;propane |
| SMILES | CC(CCC(=O)NC=O)N1C(=O)c2cccc(OCCCCN)c2C1=O.CCC |
| InChI | InChI=1S/C18H23N3O5.C3H8/c1-12(7-8-15(23)20-11-22)21-17(24)13-5-4-6-14(16(13)18(21)25)26-10-3-2-9-19;1-3-2/h4-6,11-12H,2-3,7-10,19H2,1H3,(H,20,22,23);3H2,1-2H3 |
| InChIKey | FWNHOLXHPPLFPH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|