C14H14N2O5 — CID 170244907
N-formyl-4-(4-hydroxy-1,3-dioxoisoindol-2-yl)pentanamide (PubChem CID 170244907) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is N-formyl-4-(4-hydroxy-1,3-dioxoisoindol-2-yl)pentanamide.
| Compound Name | N-formyl-4-(4-hydroxy-1,3-dioxoisoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 170244907 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-formyl-4-(4-hydroxy-1,3-dioxoisoindol-2-yl)pentanamide |
| SMILES | CC(CCC(=O)NC=O)N1C(=O)c2cccc(O)c2C1=O |
| InChI | InChI=1S/C14H14N2O5/c1-8(5-6-11(19)15-7-17)16-13(20)9-3-2-4-10(18)12(9)14(16)21/h2-4,7-8,18H,5-6H2,1H3,(H,15,17,19) |
| InChIKey | SOFKKKNABMQDFB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|