C28H32N4O6 — CID 145256263
4-[4-[2-[[4-(aminomethyl)phenyl]methylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene (PubChem CID 145256263) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is 4-[4-[2-[[4-(aminomethyl)phenyl]methylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene.
| Compound Name | 4-[4-[2-[[4-(aminomethyl)phenyl]methylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene |
|---|---|
| PubChem CID | 145256263 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 4-[4-[2-[[4-(aminomethyl)phenyl]methylamino]-2-oxoethoxy]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene |
| SMILES | C=CC=C.CC(CCC(=O)NC=O)N1C(=O)c2cccc(OCC(=O)NCc3ccc(CN)cc3)c2C1=O |
| InChI | InChI=1S/C24H26N4O6.C4H6/c1-15(5-10-20(30)27-14-29)28-23(32)18-3-2-4-19(22(18)24(28)33)34-13-21(31)26-12-17-8-6-16(11-25)7-9-17;1-3-4-2/h2-4,6-9,14-15H,5,10-13,25H2,1H3,(H,26,31)(H,27,29,30);3-4H,1-2H2 |
| InChIKey | VXWDREVLCDPSGU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|