C28H41N3O11 — CID 145256247
4-[1,3-dioxo-4-[2-oxo-2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]isoindol-2-yl]-N-methyl-5-oxopentanamide;formaldehyde (PubChem CID 145256247) has the molecular formula C28H41N3O11 and a molecular weight of 595.65 g/mol. Its IUPAC name is 4-[1,3-dioxo-4-[2-oxo-2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]isoindol-2-yl]-N-methyl-5-oxopentanamide;formaldehyde.
| Compound Name | 4-[1,3-dioxo-4-[2-oxo-2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]isoindol-2-yl]-N-methyl-5-oxopentanamide;formaldehyde |
|---|---|
| PubChem CID | 145256247 |
| Molecular Formula | C28H41N3O11 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 4-[1,3-dioxo-4-[2-oxo-2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]isoindol-2-yl]-N-methyl-5-oxopentanamide;formaldehyde |
| SMILES | C=O.CCCOCCOCCOCCOCCNC(=O)COc1cccc2c1C(=O)N(C(C=O)CCC(=O)NC)C2=O |
| InChI | InChI=1S/C27H39N3O10.CH2O/c1-3-10-36-12-14-38-16-17-39-15-13-37-11-9-29-24(33)19-40-22-6-4-5-21-25(22)27(35)30(26(21)34)20(18-31)7-8-23(32)28-2;1-2/h4-6,18,20H,3,7-17,19H2,1-2H3,(H,28,32)(H,29,33);1H2 |
| InChIKey | VMVCKAVQEAWWBP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 175.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|