C24H31N3O7 — CID 170701570
tert-butyl 4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxypiperidine-1-carboxylate (PubChem CID 170701570) has the molecular formula C24H31N3O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is tert-butyl 4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170701570 |
| Molecular Formula | C24H31N3O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | tert-butyl 4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]oxypiperidine-1-carboxylate |
| SMILES | CNC(=O)CCC(C=O)N1C(=O)c2cccc(OC3CCN(C(=O)OC(C)(C)C)CC3)c2C1=O |
| InChI | InChI=1S/C24H31N3O7/c1-24(2,3)34-23(32)26-12-10-16(11-13-26)33-18-7-5-6-17-20(18)22(31)27(21(17)30)15(14-28)8-9-19(29)25-4/h5-7,14-16H,8-13H2,1-4H3,(H,25,29) |
| InChIKey | DAJASYNUENUDSL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|