C24H38N2O4 — CID 54060976
tert-butyl 4-[2-(7-oxooctylamino)phenoxy]piperidine-1-carboxylate (PubChem CID 54060976) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl 4-[2-(7-oxooctylamino)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(7-oxooctylamino)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54060976 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | tert-butyl 4-[2-(7-oxooctylamino)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(=O)CCCCCCNc1ccccc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H38N2O4/c1-19(27)11-7-5-6-10-16-25-21-12-8-9-13-22(21)29-20-14-17-26(18-15-20)23(28)30-24(2,3)4/h8-9,12-13,20,25H,5-7,10-11,14-18H2,1-4H3 |
| InChIKey | LZRHFCRGLQWAQD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|