C24H32N4O7 — CID 156711632
tert-butyl 2-(hydroxymethyl)-4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazine-1-carboxylate (PubChem CID 156711632) has the molecular formula C24H32N4O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156711632 |
| Molecular Formula | C24H32N4O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-4-[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazine-1-carboxylate |
| SMILES | CNC(=O)CCC(C=O)N1C(=O)c2ccc(N3CCN(C(=O)OC(C)(C)C)C(CO)C3)cc2C1=O |
| InChI | InChI=1S/C24H32N4O7/c1-24(2,3)35-23(34)27-10-9-26(12-17(27)14-30)15-5-7-18-19(11-15)22(33)28(21(18)32)16(13-29)6-8-20(31)25-4/h5,7,11,13,16-17,30H,6,8-10,12,14H2,1-4H3,(H,25,31) |
| InChIKey | RNILBTHSTZGZGY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|