C17H25BrN2O4 — CID 171062856
tert-butyl 4-(3-bromo-4-methoxyphenyl)-2-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 171062856) has the molecular formula C17H25BrN2O4 and a molecular weight of 401.30 g/mol. Its IUPAC name is tert-butyl 4-(3-bromo-4-methoxyphenyl)-2-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-bromo-4-methoxyphenyl)-2-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171062856 |
| Molecular Formula | C17H25BrN2O4 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | tert-butyl 4-(3-bromo-4-methoxyphenyl)-2-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)OC(C)(C)C)C(CO)C2)cc1Br |
| InChI | InChI=1S/C17H25BrN2O4/c1-17(2,3)24-16(22)20-8-7-19(10-13(20)11-21)12-5-6-15(23-4)14(18)9-12/h5-6,9,13,21H,7-8,10-11H2,1-4H3 |
| InChIKey | MYFDUKUUFAPSSE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|