C18H27N3O5 — CID 67516677
1-O-tert-butyl 2-O-methyl (2S)-4-(4-amino-3-methoxyphenyl)piperazine-1,2-dicarboxylate (PubChem CID 67516677) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-4-(4-amino-3-methoxyphenyl)piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(4-amino-3-methoxyphenyl)piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67516677 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(4-amino-3-methoxyphenyl)piperazine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CN(c2ccc(N)c(OC)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N3O5/c1-18(2,3)26-17(23)21-9-8-20(11-14(21)16(22)25-5)12-6-7-13(19)15(10-12)24-4/h6-7,10,14H,8-9,11,19H2,1-5H3/t14-/m0/s1 |
| InChIKey | GQBGKNFYGBHJED-AWEZNQCLSA-N |
| XLogP | 1.88 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|