C17H23FN2O5 — CID 67396545
1-O-tert-butyl 2-O-methyl 4-(2-amino-5-fluorophenoxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 67396545) has the molecular formula C17H23FN2O5 and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 4-(2-amino-5-fluorophenoxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 4-(2-amino-5-fluorophenoxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67396545 |
| Molecular Formula | C17H23FN2O5 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 4-(2-amino-5-fluorophenoxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC(Oc2cc(F)ccc2N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23FN2O5/c1-17(2,3)25-16(22)20-9-11(8-13(20)15(21)23-4)24-14-7-10(18)5-6-12(14)19/h5-7,11,13H,8-9,19H2,1-4H3 |
| InChIKey | SUVMJINMZCTBEL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|