C16H21ClN2O5 — CID 178165179
1-O-tert-butyl 2-O-methyl (2R,4R)-4-[(2-chloro-3-pyridinyl)oxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 178165179) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,4R)-4-[(2-chloro-3-pyridinyl)oxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-[(2-chloro-3-pyridinyl)oxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 178165179 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-[(2-chloro-3-pyridinyl)oxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](Oc2cccnc2Cl)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21ClN2O5/c1-16(2,3)24-15(21)19-9-10(8-11(19)14(20)22-4)23-12-6-5-7-18-13(12)17/h5-7,10-11H,8-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | LHEBVAZZBUOYIR-GHMZBOCLSA-N |
| XLogP | 2.66 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|