C26H41N3O4 — CID 66826381
tert-butyl (2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate (PubChem CID 66826381) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66826381 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | tert-butyl (2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)OC(C)(C)C)[C@@H](CN3CCCC3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H41N3O4/c1-26(2,3)33-25(30)29-16-15-28(19-21(29)18-27-13-7-8-14-27)20-11-12-23(31-4)24(17-20)32-22-9-5-6-10-22/h11-12,17,21-22H,5-10,13-16,18-19H2,1-4H3/t21-/m0/s1 |
| InChIKey | FLKMTQYUXRUIJM-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|