C29H34N4O3 — CID 67289879
1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-pyrimidin-2-ylethanone (PubChem CID 67289879) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-pyrimidin-2-ylethanone.
| Compound Name | 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-pyrimidin-2-ylethanone |
|---|---|
| PubChem CID | 67289879 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-pyrimidin-2-ylethanone |
| SMILES | COc1ccc(N2CCN(C(=O)Cc3ncccn3)C(Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H34N4O3/c1-35-26-13-12-23(19-27(26)36-25-10-5-6-11-25)32-16-17-33(29(34)20-28-30-14-7-15-31-28)24(21-32)18-22-8-3-2-4-9-22/h2-4,7-9,12-15,19,24-25H,5-6,10-11,16-18,20-21H2,1H3 |
| InChIKey | NKNPRDUKHULSSO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|