C26H34N4O4 — CID 66825417
3-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanehydrazide (PubChem CID 66825417) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanehydrazide.
| Compound Name | 3-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanehydrazide |
|---|---|
| PubChem CID | 66825417 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 3-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanehydrazide |
| SMILES | COc1ccc(N2CCN(C(=O)CC(=O)NN)C(Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H34N4O4/c1-33-23-12-11-20(16-24(23)34-22-9-5-6-10-22)29-13-14-30(26(32)17-25(31)28-27)21(18-29)15-19-7-3-2-4-8-19/h2-4,7-8,11-12,16,21-22H,5-6,9-10,13-15,17-18,27H2,1H3,(H,28,31) |
| InChIKey | XOELSMPBKHSRLZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|