C27H34N2O4 — CID 67292598
[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-(1-hydroxycyclopropyl)methanone (PubChem CID 67292598) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is [2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-(1-hydroxycyclopropyl)methanone.
| Compound Name | [2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-(1-hydroxycyclopropyl)methanone |
|---|---|
| PubChem CID | 67292598 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | [2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-(1-hydroxycyclopropyl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)C3(O)CC3)C(Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H34N2O4/c1-32-24-12-11-21(18-25(24)33-23-9-5-6-10-23)28-15-16-29(26(30)27(31)13-14-27)22(19-28)17-20-7-3-2-4-8-20/h2-4,7-8,11-12,18,22-23,31H,5-6,9-10,13-17,19H2,1H3 |
| InChIKey | ACKNUZQABXIWAG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|