C29H36N2O5 — CID 66826508
methyl 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylate (PubChem CID 66826508) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is methyl 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 66826508 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | methyl 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)N2CCN(c3ccc(OC)c(OC4CCCC4)c3)CC2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H36N2O5/c1-34-25-13-12-22(19-26(25)36-24-10-6-7-11-24)30-16-17-31(27(32)29(14-15-29)28(33)35-2)23(20-30)18-21-8-4-3-5-9-21/h3-5,8-9,12-13,19,23-24H,6-7,10-11,14-18,20H2,1-2H3 |
| InChIKey | UEJZMKUBHTZIQG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|