C29H35N3O3 — CID 58188948
1-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-(1H-pyrrol-2-yl)ethanone (PubChem CID 58188948) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 1-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 58188948 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 1-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-2-(1H-pyrrol-2-yl)ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)Cc3ccc[nH]3)[C@@H](Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H35N3O3/c1-34-27-14-13-24(20-28(27)35-26-11-5-6-12-26)31-16-17-32(29(33)19-23-10-7-15-30-23)25(21-31)18-22-8-3-2-4-9-22/h2-4,7-10,13-15,20,25-26,30H,5-6,11-12,16-19,21H2,1H3/t25-/m0/s1 |
| InChIKey | ZMFVZFKAARWVFX-VWLOTQADSA-N |
| XLogP | 4.85 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|