C26H35N5O3 — CID 88582948
N'-amino-3-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanimidamide (PubChem CID 88582948) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is N'-amino-3-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanimidamide.
| Compound Name | N'-amino-3-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanimidamide |
|---|---|
| PubChem CID | 88582948 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | N'-amino-3-[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-3-oxopropanimidamide |
| SMILES | COc1ccc(N2CCN(C(=O)C/C(N)=N/N)[C@@H](Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H35N5O3/c1-33-23-12-11-20(16-24(23)34-22-9-5-6-10-22)30-13-14-31(26(32)17-25(27)29-28)21(18-30)15-19-7-3-2-4-8-19/h2-4,7-8,11-12,16,21-22H,5-6,9-10,13-15,17-18,28H2,1H3,(H2,27,29)/t21-/m0/s1 |
| InChIKey | RWZFUUPQWTUOBD-NRFANRHFSA-N |
| XLogP | 2.90 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|