C25H29F2N3O4 — CID 66826817
3-[2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazin-1-yl]-3-oxopropanamide (PubChem CID 66826817) has the molecular formula C25H29F2N3O4 and a molecular weight of 473.52 g/mol. Its IUPAC name is 3-[2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazin-1-yl]-3-oxopropanamide.
| Compound Name | 3-[2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazin-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 66826817 |
| Molecular Formula | C25H29F2N3O4 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-[2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazin-1-yl]-3-oxopropanamide |
| SMILES | NC(=O)CC(=O)N1CCN(c2ccc(OC(F)F)c(OC3CCC3)c2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C25H29F2N3O4/c26-25(27)34-21-10-9-18(14-22(21)33-20-7-4-8-20)29-11-12-30(24(32)15-23(28)31)19(16-29)13-17-5-2-1-3-6-17/h1-3,5-6,9-10,14,19-20,25H,4,7-8,11-13,15-16H2,(H2,28,31) |
| InChIKey | TUTHVXRMENKPHT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|