C23H27F2N3O3 — CID 66826242
2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazine-1-carboxamide (PubChem CID 66826242) has the molecular formula C23H27F2N3O3 and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazine-1-carboxamide.
| Compound Name | 2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 66826242 |
| Molecular Formula | C23H27F2N3O3 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-benzyl-4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2ccc(OC(F)F)c(OC3CCC3)c2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C23H27F2N3O3/c24-22(25)31-20-10-9-17(14-21(20)30-19-7-4-8-19)27-11-12-28(23(26)29)18(15-27)13-16-5-2-1-3-6-16/h1-3,5-6,9-10,14,18-19,22H,4,7-8,11-13,15H2,(H2,26,29) |
| InChIKey | KXDPRAANQQJNFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|