C21H23F4N3O3 — CID 67292661
2-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]acetamide (PubChem CID 67292661) has the molecular formula C21H23F4N3O3 and a molecular weight of 441.43 g/mol. Its IUPAC name is 2-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]acetamide.
| Compound Name | 2-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 67292661 |
| Molecular Formula | C21H23F4N3O3 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCN(c2ccc(OC(F)F)c(OC(F)F)c2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C21H23F4N3O3/c22-20(23)30-17-7-6-15(11-18(17)31-21(24)25)27-8-9-28(13-19(26)29)16(12-27)10-14-4-2-1-3-5-14/h1-7,11,16,20-21H,8-10,12-13H2,(H2,26,29) |
| InChIKey | FLBKWQMYZPGMGU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|