C26H36N4O3 — CID 66826593
2-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-N'-methylacetohydrazide (PubChem CID 66826593) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-N'-methylacetohydrazide.
| Compound Name | 2-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 66826593 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-N'-methylacetohydrazide |
| SMILES | CNNC(=O)CN1CCN(c2ccc(OC)c(OC3CCCC3)c2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C26H36N4O3/c1-27-28-26(31)19-30-15-14-29(18-22(30)16-20-8-4-3-5-9-20)21-12-13-24(32-2)25(17-21)33-23-10-6-7-11-23/h3-5,8-9,12-13,17,22-23,27H,6-7,10-11,14-16,18-19H2,1-2H3,(H,28,31) |
| InChIKey | IFUZBEOFAVNRLD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|