C26H34N2O3 — CID 66824781
1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]propan-2-one (PubChem CID 66824781) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]propan-2-one.
| Compound Name | 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 66824781 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 1-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]propan-2-one |
| SMILES | COc1ccc(N2CCN(CC(C)=O)C(Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H34N2O3/c1-20(29)18-27-14-15-28(19-23(27)16-21-8-4-3-5-9-21)22-12-13-25(30-2)26(17-22)31-24-10-6-7-11-24/h3-5,8-9,12-13,17,23-24H,6-7,10-11,14-16,18-19H2,1-2H3 |
| InChIKey | NQOKHVFVXPCCCI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|