C29H38N2O5 — CID 123451512
ethyl 4-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate (PubChem CID 123451512) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is ethyl 4-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 123451512 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | ethyl 4-[2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCN(c2ccc(OC)c(OC3CCCC3)c2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C29H38N2O5/c1-3-35-29(33)16-15-28(32)31-18-17-30(21-24(31)19-22-9-5-4-6-10-22)23-13-14-26(34-2)27(20-23)36-25-11-7-8-12-25/h4-6,9-10,13-14,20,24-25H,3,7-8,11-12,15-19,21H2,1-2H3 |
| InChIKey | RZNWTOOIOYNCII-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|