C28H33N3O3 — CID 123468996
2-[(2S)-2-benzyl-4-(3-cyclobutyloxy-4-methoxyphenyl)piperazin-1-yl]-1-(1H-pyrrol-3-yl)ethanone (PubChem CID 123468996) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[(2S)-2-benzyl-4-(3-cyclobutyloxy-4-methoxyphenyl)piperazin-1-yl]-1-(1H-pyrrol-3-yl)ethanone.
| Compound Name | 2-[(2S)-2-benzyl-4-(3-cyclobutyloxy-4-methoxyphenyl)piperazin-1-yl]-1-(1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 123468996 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 2-[(2S)-2-benzyl-4-(3-cyclobutyloxy-4-methoxyphenyl)piperazin-1-yl]-1-(1H-pyrrol-3-yl)ethanone |
| SMILES | COc1ccc(N2CCN(CC(=O)c3cc[nH]c3)[C@@H](Cc3ccccc3)C2)cc1OC1CCC1 |
| InChI | InChI=1S/C28H33N3O3/c1-33-27-11-10-23(17-28(27)34-25-8-5-9-25)30-14-15-31(20-26(32)22-12-13-29-18-22)24(19-30)16-21-6-3-2-4-7-21/h2-4,6-7,10-13,17-18,24-25,29H,5,8-9,14-16,19-20H2,1H3/t24-/m0/s1 |
| InChIKey | PNGFPZIOGXZKOO-DEOSSOPVSA-N |
| XLogP | 4.57 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|