C24H28N4O3 — CID 66825474
2-[2-benzyl-4-(2,8-dimethoxyquinolin-5-yl)piperazin-1-yl]acetamide (PubChem CID 66825474) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[2-benzyl-4-(2,8-dimethoxyquinolin-5-yl)piperazin-1-yl]acetamide.
| Compound Name | 2-[2-benzyl-4-(2,8-dimethoxyquinolin-5-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 66825474 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-[2-benzyl-4-(2,8-dimethoxyquinolin-5-yl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc2c(N3CCN(CC(N)=O)C(Cc4ccccc4)C3)ccc(OC)c2n1 |
| InChI | InChI=1S/C24H28N4O3/c1-30-21-10-9-20(19-8-11-23(31-2)26-24(19)21)28-13-12-27(16-22(25)29)18(15-28)14-17-6-4-3-5-7-17/h3-11,18H,12-16H2,1-2H3,(H2,25,29) |
| InChIKey | MLJFEWDBFJLLHD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|