C22H26N4O3S — CID 58188971
(2S)-2-benzyl-4-(8-methoxy-2-methylquinolin-5-yl)piperazine-1-sulfonamide (PubChem CID 58188971) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is (2S)-2-benzyl-4-(8-methoxy-2-methylquinolin-5-yl)piperazine-1-sulfonamide.
| Compound Name | (2S)-2-benzyl-4-(8-methoxy-2-methylquinolin-5-yl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 58188971 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (2S)-2-benzyl-4-(8-methoxy-2-methylquinolin-5-yl)piperazine-1-sulfonamide |
| SMILES | COc1ccc(N2CCN(S(N)(=O)=O)[C@@H](Cc3ccccc3)C2)c2ccc(C)nc12 |
| InChI | InChI=1S/C22H26N4O3S/c1-16-8-9-19-20(10-11-21(29-2)22(19)24-16)25-12-13-26(30(23,27)28)18(15-25)14-17-6-4-3-5-7-17/h3-11,18H,12-15H2,1-2H3,(H2,23,27,28)/t18-/m0/s1 |
| InChIKey | RNFUFSQOSFZCCZ-SFHVURJKSA-N |
| XLogP | 2.49 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|