C24H32N2O4S — CID 67272644
2-benzyl-4-(4-methoxyphenyl)-1-methylsulfonylpiperazine;5-oxabicyclo[2.1.1]hexane (PubChem CID 67272644) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-benzyl-4-(4-methoxyphenyl)-1-methylsulfonylpiperazine;5-oxabicyclo[2.1.1]hexane.
| Compound Name | 2-benzyl-4-(4-methoxyphenyl)-1-methylsulfonylpiperazine;5-oxabicyclo[2.1.1]hexane |
|---|---|
| PubChem CID | 67272644 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-benzyl-4-(4-methoxyphenyl)-1-methylsulfonylpiperazine;5-oxabicyclo[2.1.1]hexane |
| SMILES | C1CC2CC1O2.COc1ccc(N2CCN(S(C)(=O)=O)C(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H24N2O3S.C5H8O/c1-24-19-10-8-17(9-11-19)20-12-13-21(25(2,22)23)18(15-20)14-16-6-4-3-5-7-16;1-2-5-3-4(1)6-5/h3-11,18H,12-15H2,1-2H3;4-5H,1-3H2 |
| InChIKey | FEKCKDOKXZLSQV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|