C22H26N4O3 — CID 51565311
(5S)-5-benzyl-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 51565311) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51565311 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (5S)-5-benzyl-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(N2CCN(CN3C(=O)N[C@@H](Cc4ccccc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-29-19-9-7-18(8-10-19)25-13-11-24(12-14-25)16-26-21(27)20(23-22(26)28)15-17-5-3-2-4-6-17/h2-10,20H,11-16H2,1H3,(H,23,28)/t20-/m0/s1 |
| InChIKey | LCDAAZGGWJLDQZ-FQEVSTJZSA-N |
| XLogP | 1.94 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|