C20H25N5O5S — CID 45355223
5-benzyl-3-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 45355223) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is 5-benzyl-3-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-benzyl-3-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45355223 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 5-benzyl-3-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(CN2C(=O)NC(Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C20H25N5O5S/c1-14-18(15(2)30-22-14)31(28,29)24-10-8-23(9-11-24)13-25-19(26)17(21-20(25)27)12-16-6-4-3-5-7-16/h3-7,17H,8-13H2,1-2H3,(H,21,27) |
| InChIKey | XXOVLGAKAIEJGB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|