C21H24N4O3 — CID 71520460
5-(2-methoxyphenyl)-3-[(4-phenylpiperazin-1-yl)methyl]imidazolidine-2,4-dione (PubChem CID 71520460) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-3-[(4-phenylpiperazin-1-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2-methoxyphenyl)-3-[(4-phenylpiperazin-1-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71520460 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 5-(2-methoxyphenyl)-3-[(4-phenylpiperazin-1-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccccc1C1NC(=O)N(CN2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C21H24N4O3/c1-28-18-10-6-5-9-17(18)19-20(26)25(21(27)22-19)15-23-11-13-24(14-12-23)16-7-3-2-4-8-16/h2-10,19H,11-15H2,1H3,(H,22,27) |
| InChIKey | SSLUDQQFWOOVQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|