C40H46N8O2S2 — CID 5303094
2,6-bis[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 5303094) has the molecular formula C40H46N8O2S2 and a molecular weight of 735.00 g/mol. Its IUPAC name is 2,6-bis[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | 2,6-bis[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 5303094 |
| Molecular Formula | C40H46N8O2S2 |
| Molecular Weight | 735.00 g/mol |
| Exact Mass | 734.32 |
| IUPAC Name | 2,6-bis[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | COc1ccc(N2CCN(CN3C(=S)N4C(c5ccccc5)N(CN5CCN(c6ccc(OC)cc6)CC5)C(=S)N4C3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C40H46N8O2S2/c1-49-35-17-13-33(14-18-35)43-25-21-41(22-26-43)29-45-37(31-9-5-3-6-10-31)47-40(52)46(38(48(47)39(45)51)32-11-7-4-8-12-32)30-42-23-27-44(28-24-42)34-15-19-36(50-2)20-16-34/h3-20,37-38H,21-30H2,1-2H3 |
| InChIKey | ATCCOXHBYHXTJE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 44.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.00 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|