C20H28N4O2 — CID 17441020
6-methyl-3-[(4-phenylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 17441020) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 6-methyl-3-[(4-phenylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 6-methyl-3-[(4-phenylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 17441020 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 6-methyl-3-[(4-phenylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCCCC12NC(=O)N(CN1CCN(c3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C20H28N4O2/c1-16-7-5-6-10-20(16)18(25)24(19(26)21-20)15-22-11-13-23(14-12-22)17-8-3-2-4-9-17/h2-4,8-9,16H,5-7,10-15H2,1H3,(H,21,26) |
| InChIKey | VAZJYJUISBMXJC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|