C28H35N5O3 — CID 41083816
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 41083816) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 41083816 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(CC(=O)Nc1ccc(N3CCN(Cc4ccccc4)CC3)cc1)C2=O |
| InChI | InChI=1S/C28H35N5O3/c1-21-7-5-6-14-28(21)26(35)33(27(36)30-28)20-25(34)29-23-10-12-24(13-11-23)32-17-15-31(16-18-32)19-22-8-3-2-4-9-22/h2-4,8-13,21H,5-7,14-20H2,1H3,(H,29,34)(H,30,36)/t21-,28+/m0/s1 |
| InChIKey | IJJHGQUBOSCSLP-RBTNQOKQSA-N |
| XLogP | 3.45 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|