C18H26N4O4S2 — CID 31317083
(5S,6R)-6-methyl-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 31317083) has the molecular formula C18H26N4O4S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is (5S,6R)-6-methyl-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6R)-6-methyl-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 31317083 |
| Molecular Formula | C18H26N4O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (5S,6R)-6-methyl-3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N(CN1CCN(S(=O)(=O)c3cccs3)CC1)C2=O |
| InChI | InChI=1S/C18H26N4O4S2/c1-14-5-2-3-7-18(14)16(23)22(17(24)19-18)13-20-8-10-21(11-9-20)28(25,26)15-6-4-12-27-15/h4,6,12,14H,2-3,5,7-11,13H2,1H3,(H,19,24)/t14-,18+/m1/s1 |
| InChIKey | JBHXEWKJRVXYEO-KDOFPFPSSA-N |
| XLogP | 1.51 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|