C17H23N3O3S — CID 40881449
N-methyl-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 40881449) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-methyl-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-methyl-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 40881449 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-methyl-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(CC(=O)N(C)Cc1cccs1)C2=O |
| InChI | InChI=1S/C17H23N3O3S/c1-12-6-3-4-8-17(12)15(22)20(16(23)18-17)11-14(21)19(2)10-13-7-5-9-24-13/h5,7,9,12H,3-4,6,8,10-11H2,1-2H3,(H,18,23)/t12-,17+/m0/s1 |
| InChIKey | XKNDRNRPFDHHRS-YVEFUNNKSA-N |
| XLogP | 2.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|