C19H23Cl2N3O3 — CID 78727003
N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 78727003) has the molecular formula C19H23Cl2N3O3 and a molecular weight of 412.32 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 78727003 |
| Molecular Formula | C19H23Cl2N3O3 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CCCCC12NC(=O)N(CC(=O)N(C)Cc1ccc(Cl)c(Cl)c1)C2=O |
| InChI | InChI=1S/C19H23Cl2N3O3/c1-12-5-3-4-8-19(12)17(26)24(18(27)22-19)11-16(25)23(2)10-13-6-7-14(20)15(21)9-13/h6-7,9,12H,3-5,8,10-11H2,1-2H3,(H,22,27) |
| InChIKey | CRLDKBQKSXMWDN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|