C18H25N3O3S — CID 51268028
N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 51268028) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 51268028 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-methyl-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(c1cccs1)N(C)C(=O)CN1C(=O)NC2(CCCCC2C)C1=O |
| InChI | InChI=1S/C18H25N3O3S/c1-12-7-4-5-9-18(12)16(23)21(17(24)19-18)11-15(22)20(3)13(2)14-8-6-10-25-14/h6,8,10,12-13H,4-5,7,9,11H2,1-3H3,(H,19,24) |
| InChIKey | PGWMDAUVZNQZND-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|