C17H24N4O4S2 — CID 2549443
3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2549443) has the molecular formula C17H24N4O4S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2549443 |
| Molecular Formula | C17H24N4O4S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-[(4-thiophen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1CN1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H24N4O4S2/c22-15-17(6-2-1-3-7-17)18-16(23)21(15)13-19-8-10-20(11-9-19)27(24,25)14-5-4-12-26-14/h4-5,12H,1-3,6-11,13H2,(H,18,23) |
| InChIKey | BVYFGQCXOHIAOM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|