C19H33N5O5S — CID 51880398
3-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 51880398) has the molecular formula C19H33N5O5S and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 51880398 |
| Molecular Formula | C19H33N5O5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 3-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CN(S(=O)(=O)N2CCN(CN3C(=O)NC4(CCCCC4)C3=O)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H33N5O5S/c1-15-12-23(13-16(2)29-15)30(27,28)22-10-8-21(9-11-22)14-24-17(25)19(20-18(24)26)6-4-3-5-7-19/h15-16H,3-14H2,1-2H3,(H,20,26)/t15-,16-/m0/s1 |
| InChIKey | GYOYVSJJIJQHJH-HOTGVXAUSA-N |
| XLogP | 0.17 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|