C22H32N4O4S — CID 26941258
3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 26941258) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 26941258 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(CN3C(=O)NC4(CCCCCC4)C3=O)CC2)c1 |
| InChI | InChI=1S/C22H32N4O4S/c1-17-7-8-18(2)19(15-17)31(29,30)25-13-11-24(12-14-25)16-26-20(27)22(23-21(26)28)9-5-3-4-6-10-22/h7-8,15H,3-6,9-14,16H2,1-2H3,(H,23,28) |
| InChIKey | BFFBVSCMPQPHSL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|