C20H28N4O4S — CID 9235504
(5S)-5-cyclopropyl-3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 9235504) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is (5S)-5-cyclopropyl-3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-cyclopropyl-3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9235504 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (5S)-5-cyclopropyl-3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(CN3C(=O)N[C@@](C)(C4CC4)C3=O)CC2)c1 |
| InChI | InChI=1S/C20H28N4O4S/c1-14-4-5-15(2)17(12-14)29(27,28)23-10-8-22(9-11-23)13-24-18(25)20(3,16-6-7-16)21-19(24)26/h4-5,12,16H,6-11,13H2,1-3H3,(H,21,26)/t20-/m0/s1 |
| InChIKey | OEIOPKBVGHOTIN-FQEVSTJZSA-N |
| XLogP | 1.29 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|