C16H20N2O4S — CID 99781725
(5S)-5-cyclopropyl-5-methyl-3-[(3-methyl-4-methylsulfonylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 99781725) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is (5S)-5-cyclopropyl-5-methyl-3-[(3-methyl-4-methylsulfonylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-cyclopropyl-5-methyl-3-[(3-methyl-4-methylsulfonylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99781725 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (5S)-5-cyclopropyl-5-methyl-3-[(3-methyl-4-methylsulfonylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(CN2C(=O)N[C@@](C)(C3CC3)C2=O)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H20N2O4S/c1-10-8-11(4-7-13(10)23(3,21)22)9-18-14(19)16(2,12-5-6-12)17-15(18)20/h4,7-8,12H,5-6,9H2,1-3H3,(H,17,20)/t16-/m0/s1 |
| InChIKey | RRKIKSVVEHFUHR-INIZCTEOSA-N |
| XLogP | 1.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|