C15H17N3O5S — CID 155527664
4-[1-(2-cyclopropyl-2-oxoethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide (PubChem CID 155527664) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-[1-(2-cyclopropyl-2-oxoethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide.
| Compound Name | 4-[1-(2-cyclopropyl-2-oxoethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155527664 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-[1-(2-cyclopropyl-2-oxoethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide |
| SMILES | CC1(c2ccc(S(N)(=O)=O)cc2)NC(=O)N(CC(=O)C2CC2)C1=O |
| InChI | InChI=1S/C15H17N3O5S/c1-15(10-4-6-11(7-5-10)24(16,22)23)13(20)18(14(21)17-15)8-12(19)9-2-3-9/h4-7,9H,2-3,8H2,1H3,(H,17,21)(H2,16,22,23) |
| InChIKey | CZQPOADORFDROM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|