C11H12N2O4S — CID 16785364
5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione (PubChem CID 16785364) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 16785364 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-methyl-5-(4-methylsulfonylphenyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(S(C)(=O)=O)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C11H12N2O4S/c1-11(9(14)12-10(15)13-11)7-3-5-8(6-4-7)18(2,16)17/h3-6H,1-2H3,(H2,12,13,14,15) |
| InChIKey | MRCYMBAGHCOXEX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|