C10H9FN2O4S — CID 13312640
5-(5-fluoro-2-methylsulfonylphenyl)imidazolidine-2,4-dione (PubChem CID 13312640) has the molecular formula C10H9FN2O4S and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-(5-fluoro-2-methylsulfonylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-(5-fluoro-2-methylsulfonylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 13312640 |
| Molecular Formula | C10H9FN2O4S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-(5-fluoro-2-methylsulfonylphenyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(F)cc1C1NC(=O)NC1=O |
| InChI | InChI=1S/C10H9FN2O4S/c1-18(16,17)7-3-2-5(11)4-6(7)8-9(14)13-10(15)12-8/h2-4,8H,1H3,(H2,12,13,14,15) |
| InChIKey | FIEPBKFDOUSQFJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|