C18H23BrN4O4S — CID 31325239
(5R)-3-[[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione (PubChem CID 31325239) has the molecular formula C18H23BrN4O4S and a molecular weight of 471.38 g/mol. Its IUPAC name is (5R)-3-[[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31325239 |
| Molecular Formula | C18H23BrN4O4S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | (5R)-3-[[4-(2-bromophenyl)sulfonylpiperazin-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(C2CC2)NC(=O)N(CN2CCN(S(=O)(=O)c3ccccc3Br)CC2)C1=O |
| InChI | InChI=1S/C18H23BrN4O4S/c1-18(13-6-7-13)16(24)23(17(25)20-18)12-21-8-10-22(11-9-21)28(26,27)15-5-3-2-4-14(15)19/h2-5,13H,6-12H2,1H3,(H,20,25)/t18-/m1/s1 |
| InChIKey | QJJHMQXVKXIPJW-GOSISDBHSA-N |
| XLogP | 1.43 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|