C18H25N4O4S+ — CID 9235330
(5S)-3-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione (PubChem CID 9235330) has the molecular formula C18H25N4O4S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is (5S)-3-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9235330 |
| Molecular Formula | C18H25N4O4S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (5S)-3-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-cyclopropyl-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(C2CC2)NC(=O)N(C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C18H24N4O4S/c1-18(14-7-8-14)16(23)22(17(24)19-18)13-20-9-11-21(12-10-20)27(25,26)15-5-3-2-4-6-15/h2-6,14H,7-13H2,1H3,(H,19,24)/p+1/t18-/m0/s1 |
| InChIKey | MVVMSMHIWTYECO-SFHVURJKSA-O |
| XLogP | -0.75 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|